C16H24N4S — CID 43076048
1-(2-bicyclo[2.2.1]heptanyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea (PubChem CID 43076048) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea |
|---|---|
| PubChem CID | 43076048 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-[[2-(dimethylamino)-3-pyridinyl]methyl]thiourea |
| SMILES | CN(C)c1ncccc1CNC(=S)NC1CC2CCC1C2 |
| InChI | InChI=1S/C16H24N4S/c1-20(2)15-13(4-3-7-17-15)10-18-16(21)19-14-9-11-5-6-12(14)8-11/h3-4,7,11-12,14H,5-6,8-10H2,1-2H3,(H2,18,19,21) |
| InChIKey | LERWYPJYALHNSY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|