C18H27N3S — CID 129377418
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-2-(dimethylamino)-2-phenylethyl]thiourea (PubChem CID 129377418) has the molecular formula C18H27N3S and a molecular weight of 317.50 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-2-(dimethylamino)-2-phenylethyl]thiourea.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-2-(dimethylamino)-2-phenylethyl]thiourea |
|---|---|
| PubChem CID | 129377418 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-2-(dimethylamino)-2-phenylethyl]thiourea |
| SMILES | CN(C)[C@@H](CNC(=S)N[C@@H]1C[C@H]2CC[C@H]1C2)c1ccccc1 |
| InChI | InChI=1S/C18H27N3S/c1-21(2)17(14-6-4-3-5-7-14)12-19-18(22)20-16-11-13-8-9-15(16)10-13/h3-7,13,15-17H,8-12H2,1-2H3,(H2,19,20,22)/t13-,15-,16+,17-/m0/s1 |
| InChIKey | APMSSFKHMBFNQG-LLLHUVSDSA-N |
| XLogP | 2.94 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|