C15H20N2S — CID 7472003
1-benzyl-3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]thiourea (PubChem CID 7472003) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 1-benzyl-3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]thiourea.
| Compound Name | 1-benzyl-3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]thiourea |
|---|---|
| PubChem CID | 7472003 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-benzyl-3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]thiourea |
| SMILES | S=C(NCc1ccccc1)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C15H20N2S/c18-15(16-10-11-4-2-1-3-5-11)17-14-9-12-6-7-13(14)8-12/h1-5,12-14H,6-10H2,(H2,16,17,18)/t12-,13-,14-/m0/s1 |
| InChIKey | VBXZMNHMHCJQAU-IHRRRGAJSA-N |
| XLogP | 2.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|