C15H22N2S — CID 7924746
1-benzyl-3-[(1S,2R)-2-methylcyclohexyl]thiourea (PubChem CID 7924746) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-benzyl-3-[(1S,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-benzyl-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 7924746 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-benzyl-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C15H22N2S/c1-12-7-5-6-10-14(12)17-15(18)16-11-13-8-3-2-4-9-13/h2-4,8-9,12,14H,5-7,10-11H2,1H3,(H2,16,17,18)/t12-,14+/m1/s1 |
| InChIKey | KKYMUHDXNQCOFT-OCCSQVGLSA-N |
| XLogP | 3.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|