C16H23FN2S — CID 24501815
1-(2,3-dimethylcyclohexyl)-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 24501815) has the molecular formula C16H23FN2S and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclohexyl)-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-(2,3-dimethylcyclohexyl)-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 24501815 |
| Molecular Formula | C16H23FN2S |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-(2,3-dimethylcyclohexyl)-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | CC1CCCC(NC(=S)NCc2ccc(F)cc2)C1C |
| InChI | InChI=1S/C16H23FN2S/c1-11-4-3-5-15(12(11)2)19-16(20)18-10-13-6-8-14(17)9-7-13/h6-9,11-12,15H,3-5,10H2,1-2H3,(H2,18,19,20) |
| InChIKey | YFBJGYBZUDJHJR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|