C17H24FN3OS — CID 11946426
1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[[2-(3-fluorophenyl)acetyl]amino]thiourea (PubChem CID 11946426) has the molecular formula C17H24FN3OS and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[[2-(3-fluorophenyl)acetyl]amino]thiourea.
| Compound Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[[2-(3-fluorophenyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 11946426 |
| Molecular Formula | C17H24FN3OS |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[[2-(3-fluorophenyl)acetyl]amino]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=S)NNC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H24FN3OS/c1-11-5-3-8-15(12(11)2)19-17(23)21-20-16(22)10-13-6-4-7-14(18)9-13/h4,6-7,9,11-12,15H,3,5,8,10H2,1-2H3,(H,20,22)(H2,19,21,23)/t11-,12-,15-/m1/s1 |
| InChIKey | KWKSPYVSCRNCNX-LALPHHSUSA-N |
| XLogP | 2.69 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|