C18H26FN3OS — CID 11943626
1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[3-(2-fluorophenyl)propanoylamino]thiourea (PubChem CID 11943626) has the molecular formula C18H26FN3OS and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[3-(2-fluorophenyl)propanoylamino]thiourea.
| Compound Name | 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[3-(2-fluorophenyl)propanoylamino]thiourea |
|---|---|
| PubChem CID | 11943626 |
| Molecular Formula | C18H26FN3OS |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[3-(2-fluorophenyl)propanoylamino]thiourea |
| SMILES | C[C@H]1[C@@H](NC(=S)NNC(=O)CCc2ccccc2F)CCC[C@@H]1C |
| InChI | InChI=1S/C18H26FN3OS/c1-12-6-5-9-16(13(12)2)20-18(24)22-21-17(23)11-10-14-7-3-4-8-15(14)19/h3-4,7-8,12-13,16H,5-6,9-11H2,1-2H3,(H,21,23)(H2,20,22,24)/t12-,13+,16-/m0/s1 |
| InChIKey | WICIKMJFOCQQMR-ZENOOKHLSA-N |
| XLogP | 3.08 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|