C23H29N3O2S — CID 11936488
1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(4-naphthalen-2-yl-4-oxobutanoyl)amino]thiourea (PubChem CID 11936488) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(4-naphthalen-2-yl-4-oxobutanoyl)amino]thiourea.
| Compound Name | 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(4-naphthalen-2-yl-4-oxobutanoyl)amino]thiourea |
|---|---|
| PubChem CID | 11936488 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(4-naphthalen-2-yl-4-oxobutanoyl)amino]thiourea |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=S)NNC(=O)CCC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H29N3O2S/c1-15-6-5-9-20(16(15)2)24-23(29)26-25-22(28)13-12-21(27)19-11-10-17-7-3-4-8-18(17)14-19/h3-4,7-8,10-11,14-16,20H,5-6,9,12-13H2,1-2H3,(H,25,28)(H2,24,26,29)/t15-,16+,20+/m0/s1 |
| InChIKey | PMAUAMGTZQBAAR-RZQQEMMASA-N |
| XLogP | 4.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|