C21H27N3OS — CID 11945979
1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[(2-naphthalen-2-ylacetyl)amino]thiourea (PubChem CID 11945979) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[(2-naphthalen-2-ylacetyl)amino]thiourea.
| Compound Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[(2-naphthalen-2-ylacetyl)amino]thiourea |
|---|---|
| PubChem CID | 11945979 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-[(2-naphthalen-2-ylacetyl)amino]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=S)NNC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H27N3OS/c1-14-6-5-9-19(15(14)2)22-21(26)24-23-20(25)13-16-10-11-17-7-3-4-8-18(17)12-16/h3-4,7-8,10-12,14-15,19H,5-6,9,13H2,1-2H3,(H,23,25)(H2,22,24,26)/t14-,15-,19-/m1/s1 |
| InChIKey | KGIFARGEZOIUOB-SPYBWZPUSA-N |
| XLogP | 3.70 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|