C18H24FN3OS — CID 11945854
1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]thiourea (PubChem CID 11945854) has the molecular formula C18H24FN3OS and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 11945854 |
| Molecular Formula | C18H24FN3OS |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=O)/C=C/c1ccccc1F |
| InChI | InChI=1S/C18H24FN3OS/c1-12-6-5-9-16(13(12)2)20-18(24)22-21-17(23)11-10-14-7-3-4-8-15(14)19/h3-4,7-8,10-13,16H,5-6,9H2,1-2H3,(H,21,23)(H2,20,22,24)/b11-10+/t12-,13-,16+/m1/s1 |
| InChIKey | SPLWWWWUXAABRX-YISPCCODSA-N |
| XLogP | 3.16 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|