C19H24ClN5OS — CID 11945892
1-[[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]amino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11945892) has the molecular formula C19H24ClN5OS and a molecular weight of 405.96 g/mol. Its IUPAC name is 1-[[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]amino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]amino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11945892 |
| Molecular Formula | C19H24ClN5OS |
| Molecular Weight | 405.96 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[[(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoyl]amino]-3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=O)/C=C/c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C19H24ClN5OS/c1-12-6-5-7-14(13(12)2)21-19(27)24-23-17(26)10-9-15-18(20)22-16-8-3-4-11-25(15)16/h3-4,8-14H,5-7H2,1-2H3,(H,23,26)(H2,21,24,27)/b10-9+/t12-,13-,14+/m1/s1 |
| InChIKey | GQDMWJIFRPFOTG-JIMGKXMDSA-N |
| XLogP | 3.32 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.96 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|