C16H22BrN3OS2 — CID 11945945
1-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11945945) has the molecular formula C16H22BrN3OS2 and a molecular weight of 416.41 g/mol. Its IUPAC name is 1-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11945945 |
| Molecular Formula | C16H22BrN3OS2 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=S)NNC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C16H22BrN3OS2/c1-10-4-3-5-13(11(10)2)18-16(22)20-19-15(21)9-7-12-6-8-14(17)23-12/h6-11,13H,3-5H2,1-2H3,(H,19,21)(H2,18,20,22)/b9-7+/t10-,11+,13+/m0/s1 |
| InChIKey | LVWZYBUEVSANCH-DVTRQFCSSA-N |
| XLogP | 3.84 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|