C14H20ClN3OS2 — CID 11946164
1-[(5-chlorothiophene-2-carbonyl)amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11946164) has the molecular formula C14H20ClN3OS2 and a molecular weight of 345.92 g/mol. Its IUPAC name is 1-[(5-chlorothiophene-2-carbonyl)amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[(5-chlorothiophene-2-carbonyl)amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11946164 |
| Molecular Formula | C14H20ClN3OS2 |
| Molecular Weight | 345.92 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-[(5-chlorothiophene-2-carbonyl)amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=S)NNC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H20ClN3OS2/c1-8-4-3-5-10(9(8)2)16-14(20)18-17-13(19)11-6-7-12(15)21-11/h6-10H,3-5H2,1-2H3,(H,17,19)(H2,16,18,20)/t8-,9-,10-/m1/s1 |
| InChIKey | IUYFERSYIWLVQP-OPRDCNLKSA-N |
| XLogP | 3.34 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.92 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|