C19H25N3OS2 — CID 11936462
1-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-3-[(3-methyl-1-benzothiophene-2-carbonyl)amino]thiourea (PubChem CID 11936462) has the molecular formula C19H25N3OS2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-3-[(3-methyl-1-benzothiophene-2-carbonyl)amino]thiourea.
| Compound Name | 1-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-3-[(3-methyl-1-benzothiophene-2-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 11936462 |
| Molecular Formula | C19H25N3OS2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-3-[(3-methyl-1-benzothiophene-2-carbonyl)amino]thiourea |
| SMILES | Cc1c(C(=O)NNC(=S)N[C@H]2CCC[C@@H](C)[C@@H]2C)sc2ccccc12 |
| InChI | InChI=1S/C19H25N3OS2/c1-11-7-6-9-15(12(11)2)20-19(24)22-21-18(23)17-13(3)14-8-4-5-10-16(14)25-17/h4-5,8,10-12,15H,6-7,9H2,1-3H3,(H,21,23)(H2,20,22,24)/t11-,12+,15+/m1/s1 |
| InChIKey | KKCFJUOFDIEFAS-XUJVJEKNSA-N |
| XLogP | 4.14 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|