C19H25N5OS — CID 11934609
1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]thiourea (PubChem CID 11934609) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]thiourea.
| Compound Name | 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 11934609 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]thiourea |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=S)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H25N5OS/c1-12-7-6-10-15(13(12)2)20-19(26)24-23-18(25)17-11-16(21-22-17)14-8-4-3-5-9-14/h3-5,8-9,11-13,15H,6-7,10H2,1-2H3,(H,21,22)(H,23,25)(H2,20,24,26)/t12-,13+,15+/m0/s1 |
| InChIKey | MUXNTFOERYPILG-GZBFAFLISA-N |
| XLogP | 3.01 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|