C24H26N2O — CID 5141902
N-(2,3-dimethylcyclohexyl)-2-phenylquinoline-4-carboxamide (PubChem CID 5141902) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 5141902 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2-phenylquinoline-4-carboxamide |
| SMILES | CC1CCCC(NC(=O)c2cc(-c3ccccc3)nc3ccccc23)C1C |
| InChI | InChI=1S/C24H26N2O/c1-16-9-8-14-21(17(16)2)26-24(27)20-15-23(18-10-4-3-5-11-18)25-22-13-7-6-12-19(20)22/h3-7,10-13,15-17,21H,8-9,14H2,1-2H3,(H,26,27) |
| InChIKey | QGMSOOCFPRZUSI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |