C26H31N3O3 — CID 20854362
2-(3,4-dimethoxyanilino)-N-(2,3-dimethylcyclohexyl)quinoline-4-carboxamide (PubChem CID 20854362) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-(3,4-dimethoxyanilino)-N-(2,3-dimethylcyclohexyl)quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethoxyanilino)-N-(2,3-dimethylcyclohexyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20854362 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-(3,4-dimethoxyanilino)-N-(2,3-dimethylcyclohexyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)NC3CCCC(C)C3C)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C26H31N3O3/c1-16-8-7-11-21(17(16)2)29-26(30)20-15-25(28-22-10-6-5-9-19(20)22)27-18-12-13-23(31-3)24(14-18)32-4/h5-6,9-10,12-17,21H,7-8,11H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | RAERCKKJRQVVEU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |