C25H29N3O — CID 20854538
2-(2,4-dimethylanilino)-N-(2-methylcyclohexyl)quinoline-4-carboxamide (PubChem CID 20854538) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)-N-(2-methylcyclohexyl)quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethylanilino)-N-(2-methylcyclohexyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20854538 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-(2,4-dimethylanilino)-N-(2-methylcyclohexyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C(=O)NC3CCCCC3C)c3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C25H29N3O/c1-16-12-13-22(18(3)14-16)26-24-15-20(19-9-5-7-11-23(19)27-24)25(29)28-21-10-6-4-8-17(21)2/h5,7,9,11-15,17,21H,4,6,8,10H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | FGTNXSLEEYKKJI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |