C26H25N3O — CID 15990880
2-(2,4-dimethylanilino)-N-(2-phenylethyl)quinoline-4-carboxamide (PubChem CID 15990880) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)-N-(2-phenylethyl)quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethylanilino)-N-(2-phenylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 15990880 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-(2,4-dimethylanilino)-N-(2-phenylethyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C(=O)NCCc3ccccc3)c3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C26H25N3O/c1-18-12-13-23(19(2)16-18)28-25-17-22(21-10-6-7-11-24(21)29-25)26(30)27-15-14-20-8-4-3-5-9-20/h3-13,16-17H,14-15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | JWPDJAHIKZZLQN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |