C26H24N2OS — CID 3491620
N-[2-(4-methylphenyl)ethyl]-2-(4-methylphenyl)sulfanylquinoline-4-carboxamide (PubChem CID 3491620) has the molecular formula C26H24N2OS and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)ethyl]-2-(4-methylphenyl)sulfanylquinoline-4-carboxamide.
| Compound Name | N-[2-(4-methylphenyl)ethyl]-2-(4-methylphenyl)sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3491620 |
| Molecular Formula | C26H24N2OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[2-(4-methylphenyl)ethyl]-2-(4-methylphenyl)sulfanylquinoline-4-carboxamide |
| SMILES | Cc1ccc(CCNC(=O)c2cc(Sc3ccc(C)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H24N2OS/c1-18-7-11-20(12-8-18)15-16-27-26(29)23-17-25(28-24-6-4-3-5-22(23)24)30-21-13-9-19(2)10-14-21/h3-14,17H,15-16H2,1-2H3,(H,27,29) |
| InChIKey | LKORLMWNLAKRDC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |