C29H31N3OS — CID 5123544
N-[3-(N-ethylanilino)propyl]-2-(4-ethylphenyl)sulfanylquinoline-4-carboxamide (PubChem CID 5123544) has the molecular formula C29H31N3OS and a molecular weight of 469.65 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-2-(4-ethylphenyl)sulfanylquinoline-4-carboxamide.
| Compound Name | N-[3-(N-ethylanilino)propyl]-2-(4-ethylphenyl)sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 5123544 |
| Molecular Formula | C29H31N3OS |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-2-(4-ethylphenyl)sulfanylquinoline-4-carboxamide |
| SMILES | CCc1ccc(Sc2cc(C(=O)NCCCN(CC)c3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H31N3OS/c1-3-22-15-17-24(18-16-22)34-28-21-26(25-13-8-9-14-27(25)31-28)29(33)30-19-10-20-32(4-2)23-11-6-5-7-12-23/h5-9,11-18,21H,3-4,10,19-20H2,1-2H3,(H,30,33) |
| InChIKey | WUCFEHDPTDRFTJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|