C27H34ClN3OS — CID 4077347
N-[3-[bis(2-methylpropyl)amino]propyl]-2-(4-chlorophenyl)sulfanylquinoline-4-carboxamide (PubChem CID 4077347) has the molecular formula C27H34ClN3OS and a molecular weight of 484.11 g/mol. Its IUPAC name is N-[3-[bis(2-methylpropyl)amino]propyl]-2-(4-chlorophenyl)sulfanylquinoline-4-carboxamide.
| Compound Name | N-[3-[bis(2-methylpropyl)amino]propyl]-2-(4-chlorophenyl)sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4077347 |
| Molecular Formula | C27H34ClN3OS |
| Molecular Weight | 484.11 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-[3-[bis(2-methylpropyl)amino]propyl]-2-(4-chlorophenyl)sulfanylquinoline-4-carboxamide |
| SMILES | CC(C)CN(CCCNC(=O)c1cc(Sc2ccc(Cl)cc2)nc2ccccc12)CC(C)C |
| InChI | InChI=1S/C27H34ClN3OS/c1-19(2)17-31(18-20(3)4)15-7-14-29-27(32)24-16-26(30-25-9-6-5-8-23(24)25)33-22-12-10-21(28)11-13-22/h5-6,8-13,16,19-20H,7,14-15,17-18H2,1-4H3,(H,29,32) |
| InChIKey | JYLVPPRANKSOLL-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.11 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|