C24H23ClN2OS — CID 4182268
2-(4-chlorophenyl)sulfanyl-N-[2-(cyclohexen-1-yl)ethyl]quinoline-4-carboxamide (PubChem CID 4182268) has the molecular formula C24H23ClN2OS and a molecular weight of 422.98 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[2-(cyclohexen-1-yl)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[2-(cyclohexen-1-yl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4182268 |
| Molecular Formula | C24H23ClN2OS |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[2-(cyclohexen-1-yl)ethyl]quinoline-4-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cc(Sc2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C24H23ClN2OS/c25-18-10-12-19(13-11-18)29-23-16-21(20-8-4-5-9-22(20)27-23)24(28)26-15-14-17-6-2-1-3-7-17/h4-6,8-13,16H,1-3,7,14-15H2,(H,26,28) |
| InChIKey | NLSWLZYRMCBTKJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|