C23H24ClN3OS — CID 4255716
2-(4-chlorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylpropyl)quinoline-4-carboxamide (PubChem CID 4255716) has the molecular formula C23H24ClN3OS and a molecular weight of 425.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylpropyl)quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4255716 |
| Molecular Formula | C23H24ClN3OS |
| Molecular Weight | 425.99 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylpropyl)quinoline-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)c1cc(Sc2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H24ClN3OS/c24-17-8-10-18(11-9-17)29-22-16-20(19-6-1-2-7-21(19)26-22)23(28)25-12-5-15-27-13-3-4-14-27/h1-2,6-11,16H,3-5,12-15H2,(H,25,28) |
| InChIKey | KUXLJYOGRVKUPU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.99 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|