C36H44Cl2N6O2 — CID 139188850
4-chloro-N-(3-piperidin-1-ylpropyl)quinoline-2-carboxamide (PubChem CID 139188850) has the molecular formula C36H44Cl2N6O2 and a molecular weight of 663.69 g/mol. Its IUPAC name is 4-chloro-N-(3-piperidin-1-ylpropyl)quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(3-piperidin-1-ylpropyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 139188850 |
| Molecular Formula | C36H44Cl2N6O2 |
| Molecular Weight | 663.69 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | 4-chloro-N-(3-piperidin-1-ylpropyl)quinoline-2-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)c1cc(Cl)c2ccccc2n1.O=C(NCCCN1CCCCC1)c1cc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/2C18H22ClN3O/c2*19-15-13-17(21-16-8-3-2-7-14(15)16)18(23)20-9-6-12-22-10-4-1-5-11-22/h2*2-3,7-8,13H,1,4-6,9-12H2,(H,20,23) |
| InChIKey | PYHIOWFCYZEMDR-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.69 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|