C15H16ClN3O2 — CID 63375816
4-chloro-N-[2-oxo-2-(propan-2-ylamino)ethyl]quinoline-2-carboxamide (PubChem CID 63375816) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is 4-chloro-N-[2-oxo-2-(propan-2-ylamino)ethyl]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-[2-oxo-2-(propan-2-ylamino)ethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 63375816 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-chloro-N-[2-oxo-2-(propan-2-ylamino)ethyl]quinoline-2-carboxamide |
| SMILES | CC(C)NC(=O)CNC(=O)c1cc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/C15H16ClN3O2/c1-9(2)18-14(20)8-17-15(21)13-7-11(16)10-5-3-4-6-12(10)19-13/h3-7,9H,8H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | PWARRHDTZJYDDM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |