C13H11ClN2O4 — CID 66166666
3-[(4-chloroquinoline-2-carbonyl)amino]-2-hydroxypropanoic acid (PubChem CID 66166666) has the molecular formula C13H11ClN2O4 and a molecular weight of 294.69 g/mol. Its IUPAC name is 3-[(4-chloroquinoline-2-carbonyl)amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(4-chloroquinoline-2-carbonyl)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66166666 |
| Molecular Formula | C13H11ClN2O4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-[(4-chloroquinoline-2-carbonyl)amino]-2-hydroxypropanoic acid |
| SMILES | O=C(NCC(O)C(=O)O)c1cc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/C13H11ClN2O4/c14-8-5-10(12(18)15-6-11(17)13(19)20)16-9-4-2-1-3-7(8)9/h1-5,11,17H,6H2,(H,15,18)(H,19,20) |
| InChIKey | VOMXRZISPCBOMK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |