C23H24ClN3O2S — CID 4053168
2-(3-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide (PubChem CID 4053168) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4053168 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-(3-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cc(Sc2cccc(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C23H24ClN3O2S/c24-17-5-3-6-18(15-17)30-22-16-20(19-7-1-2-8-21(19)26-22)23(28)25-9-4-10-27-11-13-29-14-12-27/h1-3,5-8,15-16H,4,9-14H2,(H,25,28) |
| InChIKey | QDGMVKXHTSCXMK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|