C22H23ClN3OS+ — CID 4574005
2-(3-chlorophenyl)sulfanyl-N-(2-pyrrolidin-1-ium-1-ylethyl)quinoline-4-carboxamide (PubChem CID 4574005) has the molecular formula C22H23ClN3OS+ and a molecular weight of 412.97 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfanyl-N-(2-pyrrolidin-1-ium-1-ylethyl)quinoline-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)sulfanyl-N-(2-pyrrolidin-1-ium-1-ylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4574005 |
| Molecular Formula | C22H23ClN3OS+ |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-(3-chlorophenyl)sulfanyl-N-(2-pyrrolidin-1-ium-1-ylethyl)quinoline-4-carboxamide |
| SMILES | O=C(NCC[NH+]1CCCC1)c1cc(Sc2cccc(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C22H22ClN3OS/c23-16-6-5-7-17(14-16)28-21-15-19(18-8-1-2-9-20(18)25-21)22(27)24-10-13-26-11-3-4-12-26/h1-2,5-9,14-15H,3-4,10-13H2,(H,24,27)/p+1 |
| InChIKey | BQHUPHLYIFJLFH-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |