C20H19ClN2OS — CID 4053177
N-butyl-2-(3-chlorophenyl)sulfanylquinoline-4-carboxamide (PubChem CID 4053177) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is N-butyl-2-(3-chlorophenyl)sulfanylquinoline-4-carboxamide.
| Compound Name | N-butyl-2-(3-chlorophenyl)sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4053177 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-butyl-2-(3-chlorophenyl)sulfanylquinoline-4-carboxamide |
| SMILES | CCCCNC(=O)c1cc(Sc2cccc(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C20H19ClN2OS/c1-2-3-11-22-20(24)17-13-19(23-18-10-5-4-9-16(17)18)25-15-8-6-7-14(21)12-15/h4-10,12-13H,2-3,11H2,1H3,(H,22,24) |
| InChIKey | DZRIQOSZZSKKNG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|