C23H27FN3OS+ — CID 5069378
diethyl-[3-[[2-(4-fluorophenyl)sulfanylquinoline-4-carbonyl]amino]propyl]azanium (PubChem CID 5069378) has the molecular formula C23H27FN3OS+ and a molecular weight of 412.55 g/mol. Its IUPAC name is diethyl-[3-[[2-(4-fluorophenyl)sulfanylquinoline-4-carbonyl]amino]propyl]azanium.
| Compound Name | diethyl-[3-[[2-(4-fluorophenyl)sulfanylquinoline-4-carbonyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 5069378 |
| Molecular Formula | C23H27FN3OS+ |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | diethyl-[3-[[2-(4-fluorophenyl)sulfanylquinoline-4-carbonyl]amino]propyl]azanium |
| SMILES | CC[NH+](CC)CCCNC(=O)c1cc(Sc2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H26FN3OS/c1-3-27(4-2)15-7-14-25-23(28)20-16-22(26-21-9-6-5-8-19(20)21)29-18-12-10-17(24)11-13-18/h5-6,8-13,16H,3-4,7,14-15H2,1-2H3,(H,25,28)/p+1 |
| InChIKey | TYEZZCYQBHFXKH-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|