C14H22ClFN2O — CID 20787015
diethyl-[3-[(2-fluorobenzoyl)amino]propyl]azanium chloride (PubChem CID 20787015) has the molecular formula C14H22ClFN2O and a molecular weight of 288.79 g/mol. Its IUPAC name is diethyl-[3-[(2-fluorobenzoyl)amino]propyl]azanium chloride.
| Compound Name | diethyl-[3-[(2-fluorobenzoyl)amino]propyl]azanium chloride |
|---|---|
| PubChem CID | 20787015 |
| Molecular Formula | C14H22ClFN2O |
| Molecular Weight | 288.79 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | diethyl-[3-[(2-fluorobenzoyl)amino]propyl]azanium chloride |
| SMILES | CC[NH+](CC)CCCNC(=O)c1ccccc1F.[Cl-] |
| InChI | InChI=1S/C14H21FN2O.ClH/c1-3-17(4-2)11-7-10-16-14(18)12-8-5-6-9-13(12)15;/h5-6,8-9H,3-4,7,10-11H2,1-2H3,(H,16,18);1H |
| InChIKey | LZYCLNDNMHGPGH-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.79 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|