C21H19FN2OS — CID 4185757
N-cyclopentyl-2-(4-fluorophenyl)sulfanylquinoline-4-carboxamide (PubChem CID 4185757) has the molecular formula C21H19FN2OS and a molecular weight of 366.46 g/mol. Its IUPAC name is N-cyclopentyl-2-(4-fluorophenyl)sulfanylquinoline-4-carboxamide.
| Compound Name | N-cyclopentyl-2-(4-fluorophenyl)sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4185757 |
| Molecular Formula | C21H19FN2OS |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-cyclopentyl-2-(4-fluorophenyl)sulfanylquinoline-4-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cc(Sc2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H19FN2OS/c22-14-9-11-16(12-10-14)26-20-13-18(17-7-3-4-8-19(17)24-20)21(25)23-15-5-1-2-6-15/h3-4,7-13,15H,1-2,5-6H2,(H,23,25) |
| InChIKey | ZMWBTAKJWQKVOX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |