C22H24Cl2FN3O — CID 119476850
N-(4-aminocyclohexyl)-2-(4-fluorophenyl)quinoline-4-carboxamide;dihydrochloride (PubChem CID 119476850) has the molecular formula C22H24Cl2FN3O and a molecular weight of 436.36 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(4-fluorophenyl)quinoline-4-carboxamide;dihydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-(4-fluorophenyl)quinoline-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119476850 |
| Molecular Formula | C22H24Cl2FN3O |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(4-fluorophenyl)quinoline-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(NC(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C22H22FN3O.2ClH/c23-15-7-5-14(6-8-15)21-13-19(18-3-1-2-4-20(18)26-21)22(27)25-17-11-9-16(24)10-12-17;;/h1-8,13,16-17H,9-12,24H2,(H,25,27);2*1H |
| InChIKey | XRMOXVCCKKUYNC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |