C24H25N3O2 — CID 119456905
N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(4-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 119456905) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(4-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(4-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 119456905 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(4-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NC3CC4CCC(C3)N4)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-29-19-10-6-15(7-11-19)23-14-21(20-4-2-3-5-22(20)27-23)24(28)26-18-12-16-8-9-17(13-18)25-16/h2-7,10-11,14,16-18,25H,8-9,12-13H2,1H3,(H,26,28) |
| InChIKey | QCPIZVRDIIEGDC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |