C23H29N3O2S — CID 46647045
2-[1-(cycloheptylamino)-1-oxopropan-2-yl]sulfanyl-N-cyclopropylquinoline-4-carboxamide (PubChem CID 46647045) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is 2-[1-(cycloheptylamino)-1-oxopropan-2-yl]sulfanyl-N-cyclopropylquinoline-4-carboxamide.
| Compound Name | 2-[1-(cycloheptylamino)-1-oxopropan-2-yl]sulfanyl-N-cyclopropylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 46647045 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-[1-(cycloheptylamino)-1-oxopropan-2-yl]sulfanyl-N-cyclopropylquinoline-4-carboxamide |
| SMILES | CC(Sc1cc(C(=O)NC2CC2)c2ccccc2n1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C23H29N3O2S/c1-15(22(27)24-16-8-4-2-3-5-9-16)29-21-14-19(23(28)25-17-12-13-17)18-10-6-7-11-20(18)26-21/h6-7,10-11,14-17H,2-5,8-9,12-13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | FNTVBRMRKPFLNM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |