C22H22N2OS — CID 5216224
N-cyclopropyl-2-(4-propan-2-ylphenyl)sulfanylquinoline-4-carboxamide (PubChem CID 5216224) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is N-cyclopropyl-2-(4-propan-2-ylphenyl)sulfanylquinoline-4-carboxamide.
| Compound Name | N-cyclopropyl-2-(4-propan-2-ylphenyl)sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 5216224 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-cyclopropyl-2-(4-propan-2-ylphenyl)sulfanylquinoline-4-carboxamide |
| SMILES | CC(C)c1ccc(Sc2cc(C(=O)NC3CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C22H22N2OS/c1-14(2)15-7-11-17(12-8-15)26-21-13-19(22(25)23-16-9-10-16)18-5-3-4-6-20(18)24-21/h3-8,11-14,16H,9-10H2,1-2H3,(H,23,25) |
| InChIKey | GPKPRKWAXPQHGQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |