C25H28N2O3S — CID 74633448
N-cyclopropyl-2-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]sulfanylquinoline-4-carboxamide (PubChem CID 74633448) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-cyclopropyl-2-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]sulfanylquinoline-4-carboxamide.
| Compound Name | N-cyclopropyl-2-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 74633448 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-cyclopropyl-2-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]sulfanylquinoline-4-carboxamide |
| SMILES | CC(C)c1ccccc1OCC(O)CSc1cc(C(=O)NC2CC2)c2ccccc2n1 |
| InChI | InChI=1S/C25H28N2O3S/c1-16(2)19-7-4-6-10-23(19)30-14-18(28)15-31-24-13-21(25(29)26-17-11-12-17)20-8-3-5-9-22(20)27-24/h3-10,13,16-18,28H,11-12,14-15H2,1-2H3,(H,26,29) |
| InChIKey | MOIMUBVGMYSUNR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |