C20H23N3OS — CID 71864722
2-(4-cyano-4-methylpentyl)sulfanyl-N-cyclopropylquinoline-4-carboxamide (PubChem CID 71864722) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 2-(4-cyano-4-methylpentyl)sulfanyl-N-cyclopropylquinoline-4-carboxamide.
| Compound Name | 2-(4-cyano-4-methylpentyl)sulfanyl-N-cyclopropylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 71864722 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-(4-cyano-4-methylpentyl)sulfanyl-N-cyclopropylquinoline-4-carboxamide |
| SMILES | CC(C)(C#N)CCCSc1cc(C(=O)NC2CC2)c2ccccc2n1 |
| InChI | InChI=1S/C20H23N3OS/c1-20(2,13-21)10-5-11-25-18-12-16(19(24)22-14-8-9-14)15-6-3-4-7-17(15)23-18/h3-4,6-7,12,14H,5,8-11H2,1-2H3,(H,22,24) |
| InChIKey | ZAMMAXCEGNOPSH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|