C19H25N3OS — CID 133275936
2-(2-tert-butylsulfanylethylamino)-N-cyclopropylquinoline-4-carboxamide (PubChem CID 133275936) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-(2-tert-butylsulfanylethylamino)-N-cyclopropylquinoline-4-carboxamide.
| Compound Name | 2-(2-tert-butylsulfanylethylamino)-N-cyclopropylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 133275936 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-(2-tert-butylsulfanylethylamino)-N-cyclopropylquinoline-4-carboxamide |
| SMILES | CC(C)(C)SCCNc1cc(C(=O)NC2CC2)c2ccccc2n1 |
| InChI | InChI=1S/C19H25N3OS/c1-19(2,3)24-11-10-20-17-12-15(18(23)21-13-8-9-13)14-6-4-5-7-16(14)22-17/h4-7,12-13H,8-11H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | ZPKYLARPBZFSKU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|