C22H21BrN4O2 — CID 112802306
2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-N-cyclopropylquinoline-4-carboxamide (PubChem CID 112802306) has the molecular formula C22H21BrN4O2 and a molecular weight of 453.34 g/mol. Its IUPAC name is 2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-N-cyclopropylquinoline-4-carboxamide.
| Compound Name | 2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-N-cyclopropylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 112802306 |
| Molecular Formula | C22H21BrN4O2 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]-N-cyclopropylquinoline-4-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNc1cc(C(=O)NC2CC2)c2ccccc2n1 |
| InChI | InChI=1S/C22H21BrN4O2/c1-13-10-14(23)6-9-18(13)27-21(28)12-24-20-11-17(22(29)25-15-7-8-15)16-4-2-3-5-19(16)26-20/h2-6,9-11,15H,7-8,12H2,1H3,(H,24,26)(H,25,29)(H,27,28) |
| InChIKey | TXCWKSAZZDOFCG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |