C26H23N5O2 — CID 60527078
N-cyclopropyl-2-[[3-(pyridine-4-carbonylamino)phenyl]methylamino]quinoline-4-carboxamide (PubChem CID 60527078) has the molecular formula C26H23N5O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-cyclopropyl-2-[[3-(pyridine-4-carbonylamino)phenyl]methylamino]quinoline-4-carboxamide.
| Compound Name | N-cyclopropyl-2-[[3-(pyridine-4-carbonylamino)phenyl]methylamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 60527078 |
| Molecular Formula | C26H23N5O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-cyclopropyl-2-[[3-(pyridine-4-carbonylamino)phenyl]methylamino]quinoline-4-carboxamide |
| SMILES | O=C(Nc1cccc(CNc2cc(C(=O)NC3CC3)c3ccccc3n2)c1)c1ccncc1 |
| InChI | InChI=1S/C26H23N5O2/c32-25(18-10-12-27-13-11-18)30-20-5-3-4-17(14-20)16-28-24-15-22(26(33)29-19-8-9-19)21-6-1-2-7-23(21)31-24/h1-7,10-15,19H,8-9,16H2,(H,28,31)(H,29,33)(H,30,32) |
| InChIKey | WJIGRKDNDURYGT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |