C22H19N5O — CID 175850177
5-methyl-N-[3-[(quinoxalin-2-ylamino)methyl]phenyl]pyridine-3-carboxamide (PubChem CID 175850177) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is 5-methyl-N-[3-[(quinoxalin-2-ylamino)methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 5-methyl-N-[3-[(quinoxalin-2-ylamino)methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175850177 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 5-methyl-N-[3-[(quinoxalin-2-ylamino)methyl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1cncc(C(=O)Nc2cccc(CNc3cnc4ccccc4n3)c2)c1 |
| InChI | InChI=1S/C22H19N5O/c1-15-9-17(13-23-11-15)22(28)26-18-6-4-5-16(10-18)12-25-21-14-24-19-7-2-3-8-20(19)27-21/h2-11,13-14H,12H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | VTVBBDPHMRKWGG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |