C20H26N4O — CID 133454577
N-cyclopropyl-2-[(1-methylpiperidin-3-yl)methylamino]quinoline-4-carboxamide (PubChem CID 133454577) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is N-cyclopropyl-2-[(1-methylpiperidin-3-yl)methylamino]quinoline-4-carboxamide.
| Compound Name | N-cyclopropyl-2-[(1-methylpiperidin-3-yl)methylamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 133454577 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-cyclopropyl-2-[(1-methylpiperidin-3-yl)methylamino]quinoline-4-carboxamide |
| SMILES | CN1CCCC(CNc2cc(C(=O)NC3CC3)c3ccccc3n2)C1 |
| InChI | InChI=1S/C20H26N4O/c1-24-10-4-5-14(13-24)12-21-19-11-17(20(25)22-15-8-9-15)16-6-2-3-7-18(16)23-19/h2-3,6-7,11,14-15H,4-5,8-10,12-13H2,1H3,(H,21,23)(H,22,25) |
| InChIKey | QGJIIMBPVCOCRM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |