C19H24N4O3S — CID 133274243
N-cyclopropyl-2-[(1-methylsulfonylpiperidin-3-yl)amino]quinoline-4-carboxamide (PubChem CID 133274243) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-cyclopropyl-2-[(1-methylsulfonylpiperidin-3-yl)amino]quinoline-4-carboxamide.
| Compound Name | N-cyclopropyl-2-[(1-methylsulfonylpiperidin-3-yl)amino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 133274243 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-cyclopropyl-2-[(1-methylsulfonylpiperidin-3-yl)amino]quinoline-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(Nc2cc(C(=O)NC3CC3)c3ccccc3n2)C1 |
| InChI | InChI=1S/C19H24N4O3S/c1-27(25,26)23-10-4-5-14(12-23)20-18-11-16(19(24)21-13-8-9-13)15-6-2-3-7-17(15)22-18/h2-3,6-7,11,13-14H,4-5,8-10,12H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | BOUVBCZSXQOXSI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |