C16H22N2O5S2 — CID 119182608
2-[2-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]phenyl]sulfanylpropanoic acid (PubChem CID 119182608) has the molecular formula C16H22N2O5S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[2-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 119182608 |
| Molecular Formula | C16H22N2O5S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[2-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]phenyl]sulfanylpropanoic acid |
| SMILES | CC(Sc1ccccc1C(=O)NC1CCCN(S(C)(=O)=O)C1)C(=O)O |
| InChI | InChI=1S/C16H22N2O5S2/c1-11(16(20)21)24-14-8-4-3-7-13(14)15(19)17-12-6-5-9-18(10-12)25(2,22)23/h3-4,7-8,11-12H,5-6,9-10H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | AUCYSLOQGWXACW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |