C19H26N2O5S — CID 120551828
2-[2-[[1-(3-methoxypropanoyl)piperidin-4-yl]carbamoyl]phenyl]sulfanylpropanoic acid (PubChem CID 120551828) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-[2-[[1-(3-methoxypropanoyl)piperidin-4-yl]carbamoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[[1-(3-methoxypropanoyl)piperidin-4-yl]carbamoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 120551828 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[2-[[1-(3-methoxypropanoyl)piperidin-4-yl]carbamoyl]phenyl]sulfanylpropanoic acid |
| SMILES | COCCC(=O)N1CCC(NC(=O)c2ccccc2SC(C)C(=O)O)CC1 |
| InChI | InChI=1S/C19H26N2O5S/c1-13(19(24)25)27-16-6-4-3-5-15(16)18(23)20-14-7-10-21(11-8-14)17(22)9-12-26-2/h3-6,13-14H,7-12H2,1-2H3,(H,20,23)(H,24,25) |
| InChIKey | WJKJVXHLHFIDCG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |