C14H18N2O5S — CID 119182615
4-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]benzoic acid (PubChem CID 119182615) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]benzoic acid.
| Compound Name | 4-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 119182615 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]benzoic acid |
| SMILES | CS(=O)(=O)N1CCCC(NC(=O)c2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C14H18N2O5S/c1-22(20,21)16-8-2-3-12(9-16)15-13(17)10-4-6-11(7-5-10)14(18)19/h4-7,12H,2-3,8-9H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | ZLLREIFVWDVIKV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |