C15H22N2O4S2 — CID 95305202
3-[[(R)-methylsulfinyl]methyl]-N-[(3S)-1-methylsulfonylpiperidin-3-yl]benzamide (PubChem CID 95305202) has the molecular formula C15H22N2O4S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[[(R)-methylsulfinyl]methyl]-N-[(3S)-1-methylsulfonylpiperidin-3-yl]benzamide.
| Compound Name | 3-[[(R)-methylsulfinyl]methyl]-N-[(3S)-1-methylsulfonylpiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 95305202 |
| Molecular Formula | C15H22N2O4S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-[[(R)-methylsulfinyl]methyl]-N-[(3S)-1-methylsulfonylpiperidin-3-yl]benzamide |
| SMILES | C[S@@](=O)Cc1cccc(C(=O)N[C@H]2CCCN(S(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C15H22N2O4S2/c1-22(19)11-12-5-3-6-13(9-12)15(18)16-14-7-4-8-17(10-14)23(2,20)21/h3,5-6,9,14H,4,7-8,10-11H2,1-2H3,(H,16,18)/t14-,22+/m0/s1 |
| InChIKey | MZWZTKIDXZYFGM-RCDICMHDSA-N |
| XLogP | 0.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |