About N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide
N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide (PubChem CID 15990902) has the molecular formula C24H27N3O
and a molecular weight of 373.50 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide |
| PubChem CID | 15990902 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide |
| SMILES | Cc1cc(C)cc(Nc2cc(C(=O)NC3CCCCC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C24H27N3O/c1-16-12-17(2)14-19(13-16)25-23-15-21(20-10-6-7-11-22(20)27-23)24(28)26-18-8-4-3-5-9-18/h6-7,10-15,18H,3-5,8-9H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | QLAISQDDAOJLDJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide?
The IUPAC name of N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide (CID 15990902) is N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide.
What is the SMILES notation for N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide?
The canonical SMILES for N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide is Cc1cc(C)cc(Nc2cc(C(=O)NC3CCCCC3)c3ccccc3n2)c1.
What is the InChIKey of N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide?
The InChIKey is QLAISQDDAOJLDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O/c1-16-12-17(2)14-19(13-16)25-23-15-21(20-10-6-7-11-22(20)27-23)24(28)26-18-8-4-3-5-9-18/h6-7,10-15,18H,3-5,8-9H2,1-2H3,(H,25,27)(H,26,28).
What are the key properties of N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide?
N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide has a molecular weight of 373.50 g/mol, XLogP of 5.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide is sourced from PubChem (CID 15990902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).