C24H27N3O — CID 15990902
N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide (PubChem CID 15990902) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide.
| Compound Name | N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 15990902 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-cyclohexyl-2-(3,5-dimethylanilino)quinoline-4-carboxamide |
| SMILES | Cc1cc(C)cc(Nc2cc(C(=O)NC3CCCCC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C24H27N3O/c1-16-12-17(2)14-19(13-16)25-23-15-21(20-10-6-7-11-22(20)27-23)24(28)26-18-8-4-3-5-9-18/h6-7,10-15,18H,3-5,8-9H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | QLAISQDDAOJLDJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |